On Target OPRX_HUMAN 0.4/CHEMBL3937167
For the given ligand Fenbufen, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL3937167. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL3937167 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CN(C)C1(CCC(CO)(CCCCc2ccccc2)CC1)c3ccccc3 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00000000 01000000 00100102 00010600 00080000 00000000 00000000 02001000 00000800 000808c0 08300000 40018000 00000800 01a00000 00000000 00080008 00000000 02000000 02402000 00000001 00000100 18008010 01000000 00500010 00000000 80000000 00000000 90000000 00000102 00060002 00060000 00000600 |