On Target 5HT2B_HUMAN 0.49689442/CHEMBL221811
For the given ligand Indomethacin, we have found in our database that, being scored 0.49689442, the most similar ligand is CHEMBL221811. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL221811 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | COc1ccc2[nH]c3C(C)NCCc3c2c1 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0000000a 0000c808 20100108 51010e10 00041020 00100000 060c2000 02003001 00400080 00090840 08218004 40808000 10000806 00608000 01020441 0204010c 00000000 02000026 00200400 00020200 40020000 18218008 20804000 91400010 00142000 c0000000 08120000 80000000 04000304 00060002 00040200 20004620 |