On Target MK03_HUMAN 0.325/CHEMBL3798926
For the given ligand Fenbufen, we have found in our database that, being scored 0.325, the most similar ligand is CHEMBL3798926. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL3798926 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | O=C(NCCCc1ccccc1)c2ccc3[nH]nc(c4ccncc4)c3c2 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00002002 00009a08 a0104100 40010600 01040000 00000002 02400000 22001000 00000900 000808c0 08300004 60008000 80008812 00400000 00000400 000c200c 00220000 02000004 04600000 10220201 40000100 1c068608 30800800 0060401c 00100000 c0000000 10020000 90000060 00004104 0006000b a0040400 00004620 |