On Target TRPV1_RAT 0.3902439/CHEMBL2057857
For the given ligand Ibuprofen, we have found in our database that, being scored 0.3902439, the most similar ligand is CHEMBL2057857. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL2057857 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | COc1cc(ccc1O)C(C)C(=O)NCCCc2ccc(C)c(C)c2 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 42001208 20100108 00010600 00001001 80000000 02000000 20000000 00000980 000808c0 08300000 40009800 0100c002 20200000 41000001 000c8008 00000000 02000000 00080000 00020201 00000100 18240600 01000000 81400018 00000000 80000000 00120000 10010000 04000200 0006000b 00002000 00002600 |