On Target MK01_HUMAN 0.3939394/CHEMBL3752989
For the given ligand Hydromorphone, we have found in our database that, being scored 0.3939394, the most similar ligand is CHEMBL3752989. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL3752989 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)O |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 00010000 01007208 20100100 04010600 00080080 00000000 02000000 2000000c 00000880 000808c0 08300000 4001b000 0600800a 00002001 80180000 000c0008 10000000 02000000 00402008 00020201 00000100 38240e30 03000003 83500018 00000800 80000000 00120000 10000000 0c000000 0006000b 20004000 00002600 |