On Target MK01_HUMAN 0.36818182/CHEMBL3654783
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.36818182, the most similar ligand is CHEMBL3654783. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL3654783 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | O=C(NC1CCCOc2ccccc12)Nc3cc4[nH]nc(C5CC5)c4cn3 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04000006 01801808 6018410a 40010f00 011c1004 82000102 02002004 02003601 00000a00 002c08c0 09388024 40118040 88809827 01b00000 11000241 001c200c 00a44000 2640c000 08600000 00a20041 c0000140 1c058400 25826840 80600438 00112000 c0000100 001602c0 90000080 0040831c 00064803 040c0000 80004f60 |