On Target HYES_HUMAN 0.53741497/CHEMBL1672128
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.53741497, the most similar ligand is CHEMBL1672128. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL1672128 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | COc1cccc2CCC(Cc12)C(=O)N[C@H]3C[C@@H]3c4ccccc4 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 00010000 43001208 2010010a 00010600 00001000 40000002 07000000 20000205 00100880 000808c0 08300000 40019040 04008002 21200000 01000021 02042008 00000200 02000000 00082008 00020201 00000100 18240600 00004000 81500418 00000800 c0000001 00000000 10000000 04000302 0006c00b 00000000 00402600 |