On Target TRPV3_HUMAN 0.48850575/CHEMBL3664218
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.48850575, the most similar ligand is CHEMBL3664218. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL3664218 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | COc1cccc(CNC(=O)CC2CC3(CCC3)Oc4ccc(Cl)cc24)c1OC5CCCC5 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04018000 45800218 2010010a 00210700 00081000 82000100 06000000 22001600 00000800 001808c0 08300000 40019840 0680c82e 01200010 91000601 020ca008 00800000 22008400 00482008 00020201 80000140 18008710 01000040 00548418 00002800 c0000000 00100000 90000000 00000302 0106c00b 24060000 00020640 |