On Target AMPN_HUMAN 0.39613527/CHEMBL1798008
For the given ligand Hydromorphone, we have found in our database that, being scored 0.39613527, the most similar ligand is CHEMBL1798008. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL1798008 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | CC[C@H](C)[C@@H](CN1Cc2cc(OCC(=O)NO)ccc2C[C@H]1C(=O)Nc3ccc(OC)cc3)NC(=O)CC(C)(C)C |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 0400c00a 45003218 60100128 14010602 20001020 00002000 03040000 22001008 00000880 00090ac0 083c0004 4001f000 068088a2 00302081 81021441 020c0018 10040200 820000a0 08080008 00120201 40120100 38248600 22006003 8354801a 00000800 c0000001 00164008 90000080 0c008300 0086000f 20044000 00002600 |