On Target CASP1_HUMAN 0.3846154/CHEMBL466565
For the given ligand Ibuprofen, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL466565. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL466565 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CC(C)C[C@H]1C[C@H]([C@@H](O)CC(=O)Cc2ccccc2)C(=O)N1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00030000 01001000 00100102 00010600 00180000 00000010 00000000 20000000 00000800 000a08c0 08300000 40019000 1500801a 00a00000 40000000 00080008 00000000 02000000 00c02000 00000201 00000100 18040610 01000080 00500018 00000001 80000000 00000000 10000000 00000002 00060003 00022000 00002e00 |