On Target PDE4B_HUMAN 0.32692307/CHEMBL2172710
For the given ligand Acetylsalicylic acid, we have found in our database that, being scored 0.32692307, the most similar ligand is CHEMBL2172710. Check out the elaboration below.
| Acetylsalicylic acid (Given Ligand) | CHEMBL2172710 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1ccc(\C=N\N(C)C(=O)c2ccc(O)cc2)cc1OC |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 0000000c 40000808 20000109 00010680 00001000 00000000 02040001 03005002 08000100 00000841 00200000 40008000 8000c802 00000000 01000001 0008800c 02000000 02000000 00080400 00020a00 00080000 08028600 40040002 08400004 00000000 80400800 40220000 80000000 00000308 004e060b c0240000 00000280 |