On Target NOS1_HUMAN 0.36842105/CHEMBL298404
For the given ligand Ibuprofen, we have found in our database that, being scored 0.36842105, the most similar ligand is CHEMBL298404. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL298404 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | NC(Cc1ccccc1N=C(N)N)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000002 00000000 00000100 00010e00 00000000 00000000 02002000 00000000 00000800 00080842 08100004 4000b000 04009000 40000008 000200c0 00080008 00000800 02000000 01400018 00000001 40000100 18010a00 23000040 81400010 00080800 88000000 40800000 00000800 04000000 00860002 00080000 20000500 |