On Target NK1R_HUMAN 0.4597701/CHEMBL2112368
For the given ligand Hydromorphone, we have found in our database that, being scored 0.4597701, the most similar ligand is CHEMBL2112368. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL2112368 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | COc1ccc(OC(F)(F)F)cc1[C@H]2COC3(CCCN[C@H]3c4ccccc4)C2 |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 00000040 43000008 2011010a 80010700 001910d1 40000000 02000000 22009240 00100800 000808c0 08300000 50418140 00000802 21a00000 010c1409 00083008 18000000 02000000 04482000 00020201 00010120 18008010 13000048 00500410 10000400 c0000000 00080200 d0000001 02000302 00074002 20060000 02002e00 |