On Target ALDR_HUMAN 0.39634147/CHEMBL71562
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.39634147, the most similar ligand is CHEMBL71562. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL71562 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | CCC[C@@H]1C[C@@](O)(CC(=O)O)c2cc(F)ccc2O1 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04010000 01000018 2010010a 02010300 00081000 82004010 06000000 00000a00 00000900 01082840 08100000 50009040 1680802a 02a01000 11000001 00082008 00800000 22008000 01402008 00420001 00000100 08000a20 01001040 02400410 00000800 c0000002 80000000 00000001 00100302 0003c002 40024000 00000600 |