On Target AA1R_HUMAN 0.35/CHEMBL3317575
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.35, the most similar ligand is CHEMBL3317575. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL3317575 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | COc1ccccc1CCCc2nc(N)c3nn(cc3n2)c4ccccc4 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 0000000e 81800208 2008150a 18090620 01081060 0000c000 07009010 00001a00 10100900 000d18c0 09108004 40819040 00000802 00a00000 010200c1 020c200c 10000000 06000008 01600008 00260401 c0000100 18018060 25800840 83400410 00100000 c0000000 08010000 00000880 0400030c 00c6480a 40040000 a02405e0 |