On Target PGH1_SHEEP 0.34705883/CHEMBL229957
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.34705883, the most similar ligand is CHEMBL229957. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL229957 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | COc1ccc2C=C(CCc2c1)c3ccc(OC)c(OC)c3OC |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 00080001 43000008 2000030a 00110200 20201000 40040000 c2040080 00000600 00000804 00180842 08102100 40108040 00024002 20200000 01000023 0002a00a 04000400 02000004 10080000 00020a01 00100100 18000000 0000c021 00400410 01000000 c0000001 00522000 c0000000 00400300 0002410b 04000000 00010500 |