On Target P2RX3_HUMAN 0.23863636/CHEMBL2180149
For the given ligand Ibuprofen, we have found in our database that, being scored 0.23863636, the most similar ligand is CHEMBL2180149. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL2180149 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | OC1(c2ccccc2)c3ccccc3N(Cc4ccccc4)c5ccccc15 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00014002 00000000 00000100 00010600 00000020 00084040 00000010 03001040 00002100 00080840 08200004 4000d000 04000800 00000000 00020840 00080008 00048000 02000001 0800000a 00000000 40100000 08008020 20010000 00440010 00000000 a0000000 02000008 c0001080 00088180 00260002 40040000 20000600 |