On Target NOS2_HUMAN 0.33870968/CHEMBL450583
For the given ligand Ibuprofen, we have found in our database that, being scored 0.33870968, the most similar ligand is CHEMBL450583. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL450583 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | Br.CCC(NC(=N)C)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 00000000 00100100 00010600 00000000 00000000 00000000 02001000 00000a00 00080853 08300000 40008000 00000802 00000000 00000400 00100000 00000000 02000000 00000000 00000201 00000100 18008000 00000000 00400010 00000000 c0000000 40000000 90000000 00000110 00060002 00040008 00000600 |