On Target PRGR_HUMAN 0.44578314/CHEMBL373497
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.44578314, the most similar ligand is CHEMBL373497. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL373497 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | CC(C)(CC(O)(CN1C=CC(=O)c2ccccc12)C(F)(F)F)c3cccc4CCOc34 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04001002 01000008 2410410a 00010600 00041041 82000060 02000000 00000240 02100800 c00808c0 08100004 40018040 00808802 00600000 01040041 000c601c 08000000 2200c000 04600000 00020001 40000100 18008018 23800040 a4500410 00000000 c0000000 00000060 90840014 08000300 02074002 00040000 00000600 |