On Target CXCR4_HUMAN 0.36627907/CHEMBL1949739
For the given ligand Hydromorphone, we have found in our database that, being scored 0.36627907, the most similar ligand is CHEMBL1949739. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL1949739 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | CN1[C@H](CCCNC(=O)CCCCCCCCC(=O)NCCC[C@H]2N(C)C(=O)[C@@H](Cc3ccc(O)cc3)NC(=O)CNC(=O)[C@H](Cc4ccc5ccccc5c4)NC(=O)[C@H](CCCNC(=N)N)NC2=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc6ccc7ccccc7c6)C(=O)NCC(=O)N[C@H](Cc8ccc(O)cc8)C1=O |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 00010000 01003208 20100100 04010e00 00000000 00000000 02000000 2000200c 00200a80 000808c2 08300000 4003b000 0600901a 00002001 80000000 00140008 00000000 02000000 00002008 00020201 00000100 38250638 00000003 83500018 00000800 80000000 40120000 10000000 0c000010 0006000b a00a4000 00002600 |