On Target CNR2_HUMAN 0.56050956/CHEMBL3410730
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.56050956, the most similar ligand is CHEMBL3410730. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL3410730 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | CCCCCOc1cc(ccc1OC)C(=O)NC2CCc3cc(O)c(O)cc3C2 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04000000 47001a08 2010010b 00210700 00081020 c2000000 02040000 22001005 00000880 000808c0 08300000 40808000 0080c802 00200080 11004401 220ca008 00800200 02000000 00482000 00020201 00000100 18268600 01004000 8144801c 00000000 c0000001 00320000 90000000 04000302 0006000b a0040000 00000640 |