On Target CAH2_HUMAN 0.4375/CHEMBL451332
For the given ligand Ibuprofen, we have found in our database that, being scored 0.4375, the most similar ligand is CHEMBL451332. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL451332 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | NS(=O)(=O)c1ccc(CCC(=O)O)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000010 00801000 01000100 00b10200 00000008 00000000 00000000 00000000 00000800 00080840 08102000 60009000 04008000 00000001 80200000 00080008 00000000 02000000 00400008 00002001 80000100 08040a00 01000040 08400018 00000800 80000000 00000000 00000028 00000000 20020002 00000000 00010420 |