On Target ACES_HUMAN 0.32539684/CHEMBL183394
For the given ligand STX, we have found in our database that, being scored 0.32539684, the most similar ligand is CHEMBL183394. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL183394 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CCCCNC(=O)OCCCCCCCCCCCCCCO |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000000 01401000 00100100 00010700 00080000 00008000 00000000 80000000 00000200 00000080 00200000 40008000 00008000 00800100 00000000 001a0008 00820000 00080000 00402800 00000001 00000000 10040c50 01000000 00000018 00000000 00001002 00000000 10200000 00000200 00040003 80020000 00000200 |