On Target PDE5A_HUMAN 0.3188406/CHEMBL484065
For the given ligand STX, we have found in our database that, being scored 0.3188406, the most similar ligand is CHEMBL484065. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL484065 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CCN1C(=O)C2C(N=CN2Cc2ccc(O)c(Br)c2)N2C1=N[C@@H]1CCC[C@@H]12 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 0000c040 23008408 20100140 84010e00 22000020 00080000 22c30044 22003000 40000640 00030df2 12202030 c001b000 0b00bc12 00012009 00001500 00310088 10010818 02000000 00100050 00020201 00312100 3a038620 00008013 02500218 10013090 c0000000 40630000 90001000 0a000110 01060011 801c4109 08012200 |