On Target FABP5_HUMAN 0.21176471/CHEMBL4278244
For the given ligand STX, we have found in our database that, being scored 0.21176471, the most similar ligand is CHEMBL4278244. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL4278244 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CC(=O)Nc1ccc2c(OC(=O)[C@H]3[C@@H](c4ccccc4)[C@H](C(=O)O)[C@@H]3c3ccccc3)cccc2c1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 04014002 01000008 2000010a 00010700 00081000 02000000 02000000 00000000 00000800 000a0840 08380004 40009000 0480802a 02b00010 11010041 000a2008 00860000 02000000 08402008 00020401 40100100 08000e08 31002040 00400010 00000800 80000000 00000000 00000080 00008202 00060003 00000000 10000600 |