On Target MK01_HUMAN 0.3171806/CHEMBL3663012
For the given ligand STX, we have found in our database that, being scored 0.3171806, the most similar ligand is CHEMBL3663012. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL3663012 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CN1C[C@@H](NC(=O)Nc2cc3[nH]nc(-c4ccc(F)cc4)c3cn2)[C@H](c2ccccc2)C12COC2 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00002006 01003a08 a0184100 06010f00 019c0084 00000012 02402004 2000200d 00000a80 000a09e0 08380024 60118000 8000b837 01903000 00181040 001c200c 10a60018 02404000 0c600000 00b20201 40000100 3c2f8400 33826841 83704038 00112000 80000100 100602c0 100000e1 0c40c21c 0006881b 00180200 00004f60 |