On Target TRPV3_HUMAN 0.23423423/CHEMBL3696433
For the given ligand STX, we have found in our database that, being scored 0.23423423, the most similar ligand is CHEMBL3696433. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL3696433 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CC(C)[C@H](CO)NCc1nc(-c2cc3ccccc3n2C(=O)OC(C)(C)C)ccc1F |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 0000629a 00400020 02104180 96010f00 018400a1 00180022 00400400 02083041 00000540 700c08d0 00250004 40018000 00008802 00681000 00021448 021c010d 12230200 13002026 04e00000 10500207 40100000 18018c18 33800000 a0500010 00100000 c0000002 00000240 d0041041 0000430c 00260441 60141a00 20004200 |