On Target ADRB2_HUMAN 0.3310811/CHEMBL75753
For the given ligand STX, we have found in our database that, being scored 0.3310811, the most similar ligand is CHEMBL75753. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL75753 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | O=C(NCCNCC(O)COc1ccc(O)cc1)N1CCOCC1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 04000010 00006008 20100108 84210e00 00001080 02000000 02000004 00002008 00000000 00020840 00200000 40008000 0080a002 00002000 01301009 00082108 30200010 00000000 00800040 00020200 00000100 38010400 17000081 0a000018 00000401 00000000 00880000 00800000 08000200 00060001 00000000 02000240 |