On Target CHLE_HUMAN 0.33333334/CHEMBL504924
For the given ligand STX, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL504924. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL504924 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | C/C=C(\C)C(=O)N[C@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)NC)CC[C@H]4[C@@H]3CC[C@H]2[C@H]1OC(C)=O |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000000 0100d000 00100300 80010700 00080080 00000000 00100000 20000400 01000000 00000080 00200000 c0019000 00008002 00810000 00081008 00081008 30860000 00000100 02412000 00000201 00000020 10040e10 13000000 00100018 00000400 00000000 00c80000 10000001 00000200 01040003 04020000 02002200 |