On Target PDE4B_HUMAN 0.3195266/CHEMBL144633
For the given ligand STX, we have found in our database that, being scored 0.3195266, the most similar ligand is CHEMBL144633. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL144633 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | COc1ccc([C@H]2CCN3C(=O)NC[C@@H]23)cc1OC1CCCC1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 04000000 43003208 20100108 04210f00 00081000 c2000010 02040004 2000200c 00000880 000808c0 08300000 40018000 0080d002 20002080 11000001 020ca008 00800008 02002000 00480040 00020201 00000100 38250420 01000001 83500018 00010000 80000000 00120000 10000000 0c000200 0106000b 00080000 00000640 |