On Target ACM4_HUMAN 0.4015748/CHEMBL294273
For the given ligand STX, we have found in our database that, being scored 0.4015748, the most similar ligand is CHEMBL294273. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL294273 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CC(=O)OC1CC2CCCC1N2C |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000000 01000000 00100300 80010700 00080080 00000010 00000000 20000000 00000000 00000080 00200000 50018000 00008002 00880000 00081008 00081008 10a60000 00000000 00c02000 00000201 00000020 10000a10 13000080 00100010 00000401 00000000 00000000 10001001 00000200 00040006 00020000 00002200 |