On Target NOS1_HUMAN 0.40939596/CHEMBL1270460
For the given ligand STX, we have found in our database that, being scored 0.40939596, the most similar ligand is CHEMBL1270460. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL1270460 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | N=C1CCCC(C[C@@H]2CNC[C@@H]2OCCNCCc2cccc(F)c2)N1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000000 01000000 00100100 82010f00 00180080 00000010 00000000 20002000 00200280 000828c3 08210000 50038000 00000002 00881000 00081008 00181008 10a00000 02000000 00c02000 00000201 00000020 18230030 13000080 81500010 30000400 80000000 c0000200 10000001 04200210 00068002 80020000 00002e00 |