On Target ALDR_HUMAN 0.26244345/CHEMBL84446
For the given ligand STX, we have found in our database that, being scored 0.26244345, the most similar ligand is CHEMBL84446. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL84446 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | NC(=O)[C@@H]1C[C@]2(NC(=O)NC2=O)c2cc(F)ccc2O1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 04070000 01803018 2010010a 02010f02 00101000 82000110 02000004 0a003604 00310800 002a28c0 09340000 5003f0c0 05809812 00201000 51001221 00082008 90204008 8202a100 00c00000 00420001 80020140 38358620 030010c0 81500018 00010006 c0000401 80000208 90000001 0c300300 0006c003 240c6000 80c00e40 |