On Target AA1R_HUMAN 0.46308726/CHEMBL329774
For the given ligand STX, we have found in our database that, being scored 0.46308726, the most similar ligand is CHEMBL329774. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL329774 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CCCN1C(=O)C2NC(C3CCCC3)NC2N(CCCOC(=O)CBr)C1=O |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00010000 0300b400 00100100 04010e00 00000000 00000000 00000024 20002008 00000000 000201a0 06200002 4001b000 0f00b102 00082000 80000000 00080008 00220010 00802001 00802050 00000201 00020920 301b0e10 01000081 02100018 00013403 00000000 00000000 10000100 08000200 01040015 08184009 00002200 |