On Target AOFB_HUMAN 0.25874126/CHEMBL4302260
For the given ligand STX, we have found in our database that, being scored 0.25874126, the most similar ligand is CHEMBL4302260. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL4302260 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CCC(C)(C)c1ccc(OCCCCN2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 04000000 01000008 20100108 00010700 00101000 02000000 02040000 20000000 00000800 000808c0 08300000 40018000 00800002 00000000 11000001 00082008 00000000 02000000 00402000 80020201 00000100 18000010 01000000 00500010 00000000 80000000 00120200 10000000 00000200 00060002 00000000 00002e00 |