On Target GRM5_HUMAN 0.35625/CHEMBL3087505
For the given ligand STX, we have found in our database that, being scored 0.35625, the most similar ligand is CHEMBL3087505. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL3087505 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | Cc1cccc(C#C[C@@]2(O)C[C@@H]3CC[C@H](C2)N3/C(=N/C#N)N(C)C)c1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000240 01024000 00102902 00290e00 00482101 00000010 00200004 20002000 00000200 000008c2 10200080 50018008 00005082 00801008 00000010 00198008 04800a00 02000000 00c02000 00000201 00002108 18812010 01000c81 02500011 00010007 80040000 40000000 10001000 00000010 00060200 800a0804 00002200 |