On Target P2RX3_HUMAN 0.2685185/CHEMBL3908238
For the given ligand STX, we have found in our database that, being scored 0.2685185, the most similar ligand is CHEMBL3908238. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL3908238 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CCOC(=O)CCC1CN(Cc2ccc(Cl)cc2)C(Nc2ccc(OC(C)C)c(Cl)c2)=NC1=O |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 04018046 01000418 20100108 02410f00 00081000 00000000 0a010404 23003009 00000200 001209d2 11200014 40019800 0e809c76 01008009 01000441 00181008 00864800 02400000 08500010 00024201 40022120 3a018f00 21020011 02500010 00113400 c0008800 40071000 90000080 0a008390 10060010 a41c0000 84024300 |