On Target AA2AR_HUMAN 0.34042552/CHEMBL3350613
For the given ligand STX, we have found in our database that, being scored 0.34042552, the most similar ligand is CHEMBL3350613. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL3350613 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CC(C)(C)OC(=O)C1CCCN1C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(N)=O)NC(=O)OCc1ccccc1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 01030000 01407400 00100102 84010700 00080080 0001c010 00000000 2000000c 00b00b80 000809e0 08300000 4003b000 0e008012 01212002 80381008 021a1008 10820000 02080401 00400890 00000201 00000120 38280eb0 13000041 83500018 00004400 80002002 00000000 10200021 0c000202 00060013 e0004000 00802600 |