On Target TRY1_HUMAN 0.46357617/CHEMBL112726
For the given ligand STX, we have found in our database that, being scored 0.46357617, the most similar ligand is CHEMBL112726. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL112726 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CCCC(CCC)C(=O)N[C@@H](CC(=O)OC)C(=O)N1CCCC1C(=O)N[C@H]1CCCN(C(=N)N)C1O |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00070000 01007000 00100100 04010d00 00180080 00008010 00000000 20002008 00200600 00000082 00200000 5003b000 0e00b012 01002001 80180000 00180008 10230010 00000101 00c02010 00000201 00000000 30150e60 03000083 02100018 00001001 00000000 40001200 10000000 08000212 00040001 a00a4000 00802a00 |