On Target ACE_HUMAN 0.4041096/CHEMBL342373
For the given ligand STX, we have found in our database that, being scored 0.4041096, the most similar ligand is CHEMBL342373. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL342373 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CC(NC(C(=O)O)C1CCCN1C(=O)NCC(=O)O)C(=O)N1CCCC1C(=O)O |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00010010 01007000 00100000 04000c00 00080080 00000010 00000004 20002008 00000000 00020080 00202000 40013000 0e00b01a 01802003 80180000 00080008 30000010 00000001 00c02050 00000201 00000100 30150e30 03000083 02100018 00013003 00000000 00000000 10000000 08000000 00040001 20084000 00002200 |