On Target 5HT1B_HUMAN 0.28877005/CHEMBL350153
For the given ligand STX, we have found in our database that, being scored 0.28877005, the most similar ligand is CHEMBL350153. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL350153 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CN(Cc1ccccc1)C[C@@H]1CCN(CCc2c[nH]c3ccc(C[C@H]4COC(=O)N4C)cc23)C1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000002 00405c08 00100300 41010710 00041080 00008010 00002000 a2001004 00600b80 000909e0 08300004 40028800 10008802 00400100 00001440 001e000c 00060000 02080004 00600c00 00000201 40000100 18208c18 33800040 91400018 00042000 c0001002 18000040 90000000 04400300 00060013 a0040200 00002620 |