On Target NTRK1_HUMAN 0.2934363/CHEMBL4541382
For the given ligand STX, we have found in our database that, being scored 0.2934363, the most similar ligand is CHEMBL4541382. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL4541382 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | COCCN1C[C@@H](NC(=O)Nc2c(C)c(-c3cnn(C)c3)nn2-c2ccccc2)[C@@H]2c3ccccc3CC[C@H]21 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000007 41003609 20100182 05010e10 250800a0 00006012 40c00004 2000300d 00010b84 500b09f0 09380004 60818010 0100b832 08302000 001b1840 821c604c 10060258 8ac02020 80482100 00323201 40000180 382d8434 33824801 83518038 00350003 80000001 30170210 110018e1 0c00839e 1046011b 405e0400 900026e0 |