On Target MTOR_HUMAN 0.32804233/CHEMBL371029
For the given ligand STX, we have found in our database that, being scored 0.32804233, the most similar ligand is CHEMBL371029. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL371029 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CO[C@H]1C[C@@H]2CC[C@@H](C)[C@@](O)(O2)C(=O)C(=O)N2CCCC[C@H]2C(=O)N[C@H](CCc2ccccc2)C(=O)NCC(=O)N(C)CC(=O)O[C@H]1C |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00010040 01007200 0010050a 84010700 802c00c0 00200000 00000800 20000048 04102800 010808e0 08302000 5001f000 1600800a 02a82001 80101008 082d1008 10a20000 82000000 11c02000 00000201 00000120 38040e10 17000083 0a50001c 10000401 80000000 00800000 30000021 08000200 0006000b 20a24000 00402600 |