On Target CDK5_HUMAN 0.27014217/CHEMBL1980995
For the given ligand STX, we have found in our database that, being scored 0.27014217, the most similar ligand is CHEMBL1980995. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL1980995 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CNC1CC2OC(C)(C1OC)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000002 01c09800 00100100 90010700 803c00c0 00008000 00008c01 82001044 00202000 000009d0 00200004 40018012 80008802 01ec0100 000414c0 001cd00c 08b02028 02800004 18e03000 00000001 c0080020 180686b8 37800080 8c50001c 10004400 c0200002 00008240 90000070 00400301 00060051 803d8200 00000220 |