On Target ESR1_HUMAN 0.31578946/CHEMBL4526659
For the given ligand STX, we have found in our database that, being scored 0.31578946, the most similar ligand is CHEMBL4526659. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL4526659 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CC[C@H](C)[C@@H]1NC(=O)[C@H](NC(=O)[C@@H](N)CCCCN)CSSC[C@@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)O)NC(=O)[C@H](CC(C)C)NC1=O |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00030000 81007010 60100000 44100d00 00080080 00000100 00000000 20002008 00200200 02070082 00200000 40033000 0600903e 01042001 80180000 00180008 10000000 00000000 00402000 004c2301 40000040 30050e30 03000603 06100018 00000000 00800000 40000400 10000000 08000010 00048021 a0084000 03c12200 |