On Target PTGES_HUMAN 0.2781457/CHEMBL3947494
For the given ligand STX, we have found in our database that, being scored 0.2781457, the most similar ligand is CHEMBL3947494. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL3947494 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CC1(C)CN(c2ccc(C(F)(F)F)cc2)CC[C@@H]1C(=O)N[C@H]1CCC[C@H](CO)C1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00024002 01001800 00100100 00010600 20180000 00002000 00000400 20000000 00200000 000008d0 00200004 50039000 04008002 01808000 00020040 00080008 00040000 02000000 0a402000 00000201 40100000 18040610 21000000 00500018 00000000 80000000 00000200 90000080 00008000 00060001 00120000 00802a00 |