On Target 5HT2B_HUMAN 0.3607595/CHEMBL3898995
For the given ligand STX, we have found in our database that, being scored 0.3607595, the most similar ligand is CHEMBL3898995. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL3898995 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | O=C1OC(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)CN1C1CCCC1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000000 01405400 00100300 04010600 00000080 00008000 00000000 23001000 00000200 000909e0 08202000 40018000 00008802 00002200 00181400 001a0008 10060000 02080000 00000800 00000201 00000000 380c8cd0 12000021 02500018 00000000 e0080002 10000000 d0200001 08000380 01060013 80040000 00002600 |