On Target HRH1_HUMAN 0.3442623/CHEMBL96467
For the given ligand STX, we have found in our database that, being scored 0.3442623, the most similar ligand is CHEMBL96467. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL96467 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | C[C@@H]1OC(=O)N(C(=O)NCCCN2CCC(c3ccc(F)cc3)CC2)[C@H]1c1ccc(F)c(F)c1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00000010 01c05e00 00100300 82210e10 000000c0 00008010 00020004 22003040 00000a00 000829e0 09300000 50018000 00009802 00001100 00041020 001e0008 28065000 02020180 04000840 00100201 80020100 18098c14 13000000 0050003c 00010000 80041003 90800000 90200001 00500300 0006801b 80140000 80002600 |