On Target NMDE1_HUMAN 0.1185567/CHEMBL2333945
For the given ligand STX, we have found in our database that, being scored 0.1185567, the most similar ligand is CHEMBL2333945. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL2333945 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | O=C(NNC(=O)c1ccc(CNS(=O)(=O)c2ccc(F)c(Cl)c2)cc1)c1ccccc1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 00008014 08808800 01180100 43b10600 00080000 00000010 04000801 00001000 00000100 40001848 40102000 60008800 82008804 00201201 a0200000 00000004 00002000 02100000 04400000 00006000 80000000 08028702 40000000 0840000c 02002000 80101004 40000000 0000000d 00000400 204e8002 80040000 001703e0 |