On Target MK03_HUMAN 0.28658536/CHEMBL3113587
For the given ligand STX, we have found in our database that, being scored 0.28658536, the most similar ligand is CHEMBL3113587. Check out the elaboration below.
| STX (Given Ligand) | CHEMBL3113587 (Similar Ligand) |
|---|---|
| N=C3NC1C(COC(N)=O)NC(=N)N2CCC(O)(O)C12N3 | CCCCCCCCCC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)NCCc1ccccc1 |
|
|
|
|
|
|
| 00000010 01400400 00100302 04210f00 00180080 00000010 00040005 a0002000 00200600 000201e2 06200002 40038000 0100b202 02802300 00001000 00380008 30a70010 00002000 00c02040 00000201 00000100 30032c30 13000081 02100010 00010003 00080002 40000200 30000000 08000210 00040017 801a0001 00002a00 | 01010000 01403000 00100100 04010600 00000000 00014000 00000000 2000000c 00800380 000808c0 08200000 4001b000 0e00800a 00012001 00000000 021a0008 00020000 02000400 00002890 00000201 00000000 38240e30 00000003 83500018 00000000 80002002 00000000 10200020 0c000200 00060003 e0024000 00002600 |